About S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate
S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate (PubChem CID 13472733) has the molecular formula C9H6Cl2F2OS
and a molecular weight of 271.12 g/mol. Its IUPAC name is S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate.
Molecular Properties
| Compound Name | S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate |
| PubChem CID | 13472733 |
| Molecular Formula | C9H6Cl2F2OS |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate |
| SMILES | O=C(Cl)SCC(F)(F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6Cl2F2OS/c10-7-3-1-6(2-4-7)9(12,13)5-15-8(11)14/h1-4H,5H2 |
| InChIKey | BDXSLUXFBYKKBZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate?
The IUPAC name of S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate (CID 13472733) is S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate.
What is the SMILES notation for S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate?
The canonical SMILES for S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate is O=C(Cl)SCC(F)(F)c1ccc(Cl)cc1.
What is the InChIKey of S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate?
The InChIKey is BDXSLUXFBYKKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl2F2OS/c10-7-3-1-6(2-4-7)9(12,13)5-15-8(11)14/h1-4H,5H2.
What are the key properties of S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate?
S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate has a molecular weight of 271.12 g/mol, XLogP of 4.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(4-chlorophenyl)-2,2-difluoroethyl] chloromethanethioate is sourced from PubChem (CID 13472733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).