C17H17NO2 — CID 13472816
16-azatetracyclo[8.7.1.02,7.014,18]octadeca-2,4,6,10,12,14(18)-hexaene-12,13-diol (PubChem CID 13472816) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 16-azatetracyclo[8.7.1.02,7.014,18]octadeca-2,4,6,10,12,14(18)-hexaene-12,13-diol.
| Compound Name | 16-azatetracyclo[8.7.1.02,7.014,18]octadeca-2,4,6,10,12,14(18)-hexaene-12,13-diol |
|---|---|
| PubChem CID | 13472816 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 16-azatetracyclo[8.7.1.02,7.014,18]octadeca-2,4,6,10,12,14(18)-hexaene-12,13-diol |
| SMILES | Oc1cc2c3c(c1O)CNCC3c1ccccc1CC2 |
| InChI | InChI=1S/C17H17NO2/c19-15-7-11-6-5-10-3-1-2-4-12(10)13-8-18-9-14(16(11)13)17(15)20/h1-4,7,13,18-20H,5-6,8-9H2 |
| InChIKey | ATOWBZGBEMRWHY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|