About 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole
1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole (PubChem CID 13473015) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole |
| PubChem CID | 13473015 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole |
| SMILES | CCCCN1c2ccccc2CC1C1=NCCN1 |
| InChI | InChI=1S/C15H21N3/c1-2-3-10-18-13-7-5-4-6-12(13)11-14(18)15-16-8-9-17-15/h4-7,14H,2-3,8-11H2,1H3,(H,16,17) |
| InChIKey | FWTMUMRNEWYLOY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole?
The IUPAC name of 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole (CID 13473015) is 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole.
What is the SMILES notation for 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole?
The canonical SMILES for 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole is CCCCN1c2ccccc2CC1C1=NCCN1.
What is the InChIKey of 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole?
The InChIKey is FWTMUMRNEWYLOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c1-2-3-10-18-13-7-5-4-6-12(13)11-14(18)15-16-8-9-17-15/h4-7,14H,2-3,8-11H2,1H3,(H,16,17).
What are the key properties of 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole?
1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole has a molecular weight of 243.35 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-(4,5-dihydro-1H-imidazol-2-yl)-2,3-dihydroindole is sourced from PubChem (CID 13473015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).