About 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole
2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole (PubChem CID 13473017) has the molecular formula C14H19N3
and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole |
| PubChem CID | 13473017 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole |
| SMILES | CCCN1c2ccccc2CC1C1=NCCN1 |
| InChI | InChI=1S/C14H19N3/c1-2-9-17-12-6-4-3-5-11(12)10-13(17)14-15-7-8-16-14/h3-6,13H,2,7-10H2,1H3,(H,15,16) |
| InChIKey | ZYYGDUFRXNYWNW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole (CID 13473017) is 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole is CCCN1c2ccccc2CC1C1=NCCN1.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole?
The InChIKey is ZYYGDUFRXNYWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3/c1-2-9-17-12-6-4-3-5-11(12)10-13(17)14-15-7-8-16-14/h3-6,13H,2,7-10H2,1H3,(H,15,16).
What are the key properties of 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole?
2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole has a molecular weight of 229.33 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-2-yl)-1-propyl-2,3-dihydroindole is sourced from PubChem (CID 13473017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).