C43H75NO8P+ — CID 134732547
2-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 134732547) has the molecular formula C43H75NO8P+ and a molecular weight of 765.05 g/mol. Its IUPAC name is 2-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134732547 |
| Molecular Formula | C43H75NO8P+ |
| Molecular Weight | 765.05 g/mol |
| Exact Mass | 764.52 |
| IUPAC Name | 2-[[(2R)-2-[(9E,12E)-heptadeca-9,12-dienoyl]oxy-3-[(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C/C/C=C/CCCC |
| InChI | InChI=1S/C43H74NO8P/c1-6-8-10-12-14-16-18-20-22-24-25-27-29-31-33-35-42(45)49-39-41(40-51-53(47,48)50-38-37-44(3,4)5)52-43(46)36-34-32-30-28-26-23-21-19-17-15-13-11-9-7-2/h8,10,12-16,18-22,41H,6-7,9,11,17,23-40H2,1-5H3/p+1/b10-8+,14-12+,15-13+,18-16+,21-19+,22-20+/t41-/m1/s1 |
| InChIKey | GJAOOHFEXCWODH-VPWMBBKQSA-O |
| XLogP | 11.07 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.05 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|