C43H75O8P — CID 134732943
[(2R)-2-[(11E,14E)-icosa-11,14-dienoyl]oxy-3-phosphonooxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate (PubChem CID 134732943) has the molecular formula C43H75O8P and a molecular weight of 751.04 g/mol. Its IUPAC name is [(2R)-2-[(11E,14E)-icosa-11,14-dienoyl]oxy-3-phosphonooxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate.
| Compound Name | [(2R)-2-[(11E,14E)-icosa-11,14-dienoyl]oxy-3-phosphonooxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 134732943 |
| Molecular Formula | C43H75O8P |
| Molecular Weight | 751.04 g/mol |
| Exact Mass | 750.52 |
| IUPAC Name | [(2R)-2-[(11E,14E)-icosa-11,14-dienoyl]oxy-3-phosphonooxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C43H75O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(44)49-39-41(40-50-52(46,47)48)51-43(45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h12,14,17-20,23,25,29,31,41H,3-11,13,15-16,21-22,24,26-28,30,32-40H2,1-2H3,(H2,46,47,48)/b14-12+,19-17+,20-18+,25-23+,31-29+/t41-/m1/s1 |
| InChIKey | GMOAINKYYQABFT-WGMCDUBNSA-N |
| XLogP | 12.51 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.04 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|