C49H89NO8P+ — CID 134732984
2-[[(2R)-3-[(E)-heptadec-9-enoyl]oxy-2-[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 134732984) has the molecular formula C49H89NO8P+ and a molecular weight of 851.22 g/mol. Its IUPAC name is 2-[[(2R)-3-[(E)-heptadec-9-enoyl]oxy-2-[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-3-[(E)-heptadec-9-enoyl]oxy-2-[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134732984 |
| Molecular Formula | C49H89NO8P+ |
| Molecular Weight | 851.22 g/mol |
| Exact Mass | 850.63 |
| IUPAC Name | 2-[[(2R)-3-[(E)-heptadec-9-enoyl]oxy-2-[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCC/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC |
| InChI | InChI=1S/C49H88NO8P/c1-6-8-10-12-14-16-18-20-22-23-24-25-26-27-28-30-32-34-36-38-40-42-49(52)58-47(46-57-59(53,54)56-44-43-50(3,4)5)45-55-48(51)41-39-37-35-33-31-29-21-19-17-15-13-11-9-7-2/h19,21-23,25-26,28,30,34,36,47H,6-18,20,24,27,29,31-33,35,37-46H2,1-5H3/p+1/b21-19+,23-22+,26-25+,30-28+,36-34+/t47-/m1/s1 |
| InChIKey | GMYFPZIAXAFLMQ-HBEQMYFDSA-O |
| XLogP | 13.63 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.22 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|