About [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine
[2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine (PubChem CID 13473348) has the molecular formula C6H10N4S2
and a molecular weight of 202.31 g/mol. Its IUPAC name is [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine |
| PubChem CID | 13473348 |
| Molecular Formula | C6H10N4S2 |
| Molecular Weight | 202.31 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine |
| SMILES | CSc1cc(NN)nc(SC)n1 |
| InChI | InChI=1S/C6H10N4S2/c1-11-5-3-4(10-7)8-6(9-5)12-2/h3H,7H2,1-2H3,(H,8,9,10) |
| InChIKey | GQNHXMOXLZWFIT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine?
The IUPAC name of [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine (CID 13473348) is [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine is CSc1cc(NN)nc(SC)n1.
What is the InChIKey of [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine?
The InChIKey is GQNHXMOXLZWFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4S2/c1-11-5-3-4(10-7)8-6(9-5)12-2/h3H,7H2,1-2H3,(H,8,9,10).
What are the key properties of [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine?
[2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine has a molecular weight of 202.31 g/mol, XLogP of 1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis(methylsulfanyl)pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 13473348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).