C41H68NO8P — CID 134733514
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate (PubChem CID 134733514) has the molecular formula C41H68NO8P and a molecular weight of 733.97 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 134733514 |
| Molecular Formula | C41H68NO8P |
| Molecular Weight | 733.97 g/mol |
| Exact Mass | 733.47 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (9E,12E,15E)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C/C/C=C/C/C=C/CC |
| InChI | InChI=1S/C41H68NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(43)47-37-39(38-49-51(45,46)48-36-35-42)50-41(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,23,25,39H,3-4,9-10,15-16,21-22,24,26-38,42H2,1-2H3,(H,45,46)/b7-5+,8-6+,13-11+,14-12+,19-17+,20-18+,25-23+/t39-/m1/s1 |
| InChIKey | GSEMAEHMTNTKJO-RHEWPGPSSA-N |
| XLogP | 10.49 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.97 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|