C40H73O13P — CID 134733638
[(2R)-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-heptadec-9-enoate (PubChem CID 134733638) has the molecular formula C40H73O13P and a molecular weight of 792.98 g/mol. Its IUPAC name is [(2R)-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-heptadec-9-enoate.
| Compound Name | [(2R)-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-heptadec-9-enoate |
|---|---|
| PubChem CID | 134733638 |
| Molecular Formula | C40H73O13P |
| Molecular Weight | 792.98 g/mol |
| Exact Mass | 792.48 |
| IUPAC Name | [(2R)-3-[hydroxy-[(5R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-heptadec-9-enoate |
| SMILES | CCCC/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/CCCCCCC)COP(=O)(O)OC1C(O)C(O)C(O)[C@@H](O)C1O |
| InChI | InChI=1S/C40H73O13P/c1-3-5-7-9-11-13-15-16-17-19-20-22-24-26-28-33(41)50-30-32(52-34(42)29-27-25-23-21-18-14-12-10-8-6-4-2)31-51-54(48,49)53-40-38(46)36(44)35(43)37(45)39(40)47/h10,12,15-16,32,35-40,43-47H,3-9,11,13-14,17-31H2,1-2H3,(H,48,49)/b12-10+,16-15+/t32-,35?,36-,37?,38?,39?,40?/m1/s1 |
| InChIKey | GTLDFIMOYARKIX-BARTXWIMSA-N |
| XLogP | 6.89 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.98 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|