C27H48N2O2 — CID 134733690
(4Z,8E)-6-(4-hydroxy-3-methylbutyl)-5,9,13-trimethyl-1-(4-methylpiperazin-1-yl)tetradeca-4,8,12-trien-1-one (PubChem CID 134733690) has the molecular formula C27H48N2O2 and a molecular weight of 432.69 g/mol. Its IUPAC name is (4Z,8E)-6-(4-hydroxy-3-methylbutyl)-5,9,13-trimethyl-1-(4-methylpiperazin-1-yl)tetradeca-4,8,12-trien-1-one.
| Compound Name | (4Z,8E)-6-(4-hydroxy-3-methylbutyl)-5,9,13-trimethyl-1-(4-methylpiperazin-1-yl)tetradeca-4,8,12-trien-1-one |
|---|---|
| PubChem CID | 134733690 |
| Molecular Formula | C27H48N2O2 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.37 |
| IUPAC Name | (4Z,8E)-6-(4-hydroxy-3-methylbutyl)-5,9,13-trimethyl-1-(4-methylpiperazin-1-yl)tetradeca-4,8,12-trien-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC(CCC(C)CO)/C(C)=C\CCC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C27H48N2O2/c1-22(2)9-7-10-23(3)13-15-26(16-14-24(4)21-30)25(5)11-8-12-27(31)29-19-17-28(6)18-20-29/h9,11,13,24,26,30H,7-8,10,12,14-21H2,1-6H3/b23-13+,25-11- |
| InChIKey | GTWPATCKPNRMQH-LDKJWMHBSA-N |
| XLogP | 5.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|