C32H61O10P — CID 134734409
[(2S)-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-undecanoyloxypropyl] (E)-pentadec-9-enoate (PubChem CID 134734409) has the molecular formula C32H61O10P and a molecular weight of 636.80 g/mol. Its IUPAC name is [(2S)-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-undecanoyloxypropyl] (E)-pentadec-9-enoate.
| Compound Name | [(2S)-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-undecanoyloxypropyl] (E)-pentadec-9-enoate |
|---|---|
| PubChem CID | 134734409 |
| Molecular Formula | C32H61O10P |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | [(2S)-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-undecanoyloxypropyl] (E)-pentadec-9-enoate |
| SMILES | CCCCC/C=C/CCCCCCCC(=O)OC[C@@H](COP(=O)(O)OC[C@H](O)CO)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C32H61O10P/c1-3-5-7-9-11-13-14-15-16-18-19-21-23-31(35)39-27-30(28-41-43(37,38)40-26-29(34)25-33)42-32(36)24-22-20-17-12-10-8-6-4-2/h11,13,29-30,33-34H,3-10,12,14-28H2,1-2H3,(H,37,38)/b13-11+/t29-,30+/m1/s1 |
| InChIKey | HAPOGDQIECOKSH-FVGFDQDLSA-N |
| XLogP | 7.33 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|