C36H65O13P — CID 134735257
[(2S)-2-decanoyloxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (9E,12E)-heptadeca-9,12-dienoate (PubChem CID 134735257) has the molecular formula C36H65O13P and a molecular weight of 736.88 g/mol. Its IUPAC name is [(2S)-2-decanoyloxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (9E,12E)-heptadeca-9,12-dienoate.
| Compound Name | [(2S)-2-decanoyloxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (9E,12E)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 134735257 |
| Molecular Formula | C36H65O13P |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 736.42 |
| IUPAC Name | [(2S)-2-decanoyloxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (9E,12E)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)OC[C@@H](COP(=O)(O)OC1C(O)C(O)C(O)[C@H](O)C1O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C36H65O13P/c1-3-5-7-9-11-12-13-14-15-16-17-19-20-22-24-29(37)46-26-28(48-30(38)25-23-21-18-10-8-6-4-2)27-47-50(44,45)49-36-34(42)32(40)31(39)33(41)35(36)43/h9,11,13-14,28,31-36,39-43H,3-8,10,12,15-27H2,1-2H3,(H,44,45)/b11-9+,14-13+/t28-,31?,32-,33?,34?,35?,36?/m0/s1 |
| InChIKey | HIAKTEBGSDWHMS-KLKGBGDMSA-N |
| XLogP | 5.33 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|