C41H71O10P — CID 134736891
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(E)-heptadec-9-enoyl]oxypropyl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate (PubChem CID 134736891) has the molecular formula C41H71O10P and a molecular weight of 754.98 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(E)-heptadec-9-enoyl]oxypropyl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(E)-heptadec-9-enoyl]oxypropyl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 134736891 |
| Molecular Formula | C41H71O10P |
| Molecular Weight | 754.98 g/mol |
| Exact Mass | 754.48 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(E)-heptadec-9-enoyl]oxypropyl] (6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCC/C=C/CCCCCCC |
| InChI | InChI=1S/C41H71O10P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-40(44)48-36-39(37-50-52(46,47)49-35-38(43)34-42)51-41(45)33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,16-19,22,24,38-39,42-43H,3-4,6,8-10,12,14-15,20-21,23,25-37H2,1-2H3,(H,46,47)/b7-5+,13-11+,18-16+,19-17+,24-22+/t38-,39+/m0/s1 |
| InChIKey | HWVIQOILFJUKSE-PXPVEKOESA-N |
| XLogP | 9.94 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.98 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|