C9H7N3OS — CID 13473717
8-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole (PubChem CID 13473717) has the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. Its IUPAC name is 8-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole.
| Compound Name | 8-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 13473717 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 8-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole |
| SMILES | COc1cccc2sc3nncn3c12 |
| InChI | InChI=1S/C9H7N3OS/c1-13-6-3-2-4-7-8(6)12-5-10-11-9(12)14-7/h2-5H,1H3 |
| InChIKey | GAZBYHNTJJLBRO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |