C65H108O6 — CID 134737908
[(2R)-2-[(8E,11E,14E)-icosa-8,11,14-trienoyl]oxy-3-[(E)-icos-11-enoyl]oxypropyl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate (PubChem CID 134737908) has the molecular formula C65H108O6 and a molecular weight of 985.57 g/mol. Its IUPAC name is [(2R)-2-[(8E,11E,14E)-icosa-8,11,14-trienoyl]oxy-3-[(E)-icos-11-enoyl]oxypropyl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate.
| Compound Name | [(2R)-2-[(8E,11E,14E)-icosa-8,11,14-trienoyl]oxy-3-[(E)-icos-11-enoyl]oxypropyl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 134737908 |
| Molecular Formula | C65H108O6 |
| Molecular Weight | 985.57 g/mol |
| Exact Mass | 984.81 |
| IUPAC Name | [(2R)-2-[(8E,11E,14E)-icosa-8,11,14-trienoyl]oxy-3-[(E)-icos-11-enoyl]oxypropyl] (7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCCC/C=C/CCCCCCCC)OC(=O)CCCCCC/C=C/C/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C65H108O6/c1-4-7-10-13-16-19-22-25-28-31-32-35-37-40-43-46-49-52-55-58-64(67)70-61-62(71-65(68)59-56-53-50-47-44-41-38-34-30-27-24-21-18-15-12-9-6-3)60-69-63(66)57-54-51-48-45-42-39-36-33-29-26-23-20-17-14-11-8-5-2/h7,10,16,18-19,21,25-30,32,35,38,40-41,43,62H,4-6,8-9,11-15,17,20,22-24,31,33-34,36-37,39,42,44-61H2,1-3H3/b10-7+,19-16+,21-18+,28-25+,29-26+,30-27+,35-32+,41-38+,43-40+/t62-/m1/s1 |
| InChIKey | IGKVTACPLYESER-JGLZGAKWSA-N |
| XLogP | 19.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.57 |
| LogP ≤ 5 | 19.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|