C43H78O15 — CID 134738184
[(2S)-1-decanoyloxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (E)-octadec-11-enoate (PubChem CID 134738184) has the molecular formula C43H78O15 and a molecular weight of 835.08 g/mol. Its IUPAC name is [(2S)-1-decanoyloxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (E)-octadec-11-enoate.
| Compound Name | [(2S)-1-decanoyloxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (E)-octadec-11-enoate |
|---|---|
| PubChem CID | 134738184 |
| Molecular Formula | C43H78O15 |
| Molecular Weight | 835.08 g/mol |
| Exact Mass | 834.53 |
| IUPAC Name | [(2S)-1-decanoyloxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-[[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxypropan-2-yl] (E)-octadec-11-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC)CO[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@H](O)C(O)C2O)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C43H78O15/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-24-26-35(46)56-31(28-53-34(45)25-23-21-19-10-8-6-4-2)29-54-42-41(52)39(50)37(48)33(58-42)30-55-43-40(51)38(49)36(47)32(27-44)57-43/h12-13,31-33,36-44,47-52H,3-11,14-30H2,1-2H3/b13-12+/t31-,32-,33-,36+,37+,38?,39?,40?,41?,42-,43-/m1/s1 |
| InChIKey | IIYHZQMJWHWOLG-TYRYOZMISA-N |
| XLogP | 4.26 |
| TPSA | 231.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.08 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|