C32H56NO10P — CID 134738875
(2S)-2-amino-3-[[3-[(E)-dec-4-enoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134738875) has the molecular formula C32H56NO10P and a molecular weight of 645.77 g/mol. Its IUPAC name is (2S)-2-amino-3-[[3-[(E)-dec-4-enoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[3-[(E)-dec-4-enoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134738875 |
| Molecular Formula | C32H56NO10P |
| Molecular Weight | 645.77 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | (2S)-2-amino-3-[[3-[(E)-dec-4-enoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCC/C=C/CCC(=O)OCC(COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CC/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C32H56NO10P/c1-3-5-7-9-11-12-13-14-15-16-18-20-22-24-31(35)43-28(26-41-44(38,39)42-27-29(33)32(36)37)25-40-30(34)23-21-19-17-10-8-6-4-2/h14-15,17-20,28-29H,3-13,16,21-27,33H2,1-2H3,(H,36,37)(H,38,39)/b15-14+,19-17+,20-18+/t28?,29-/m0/s1 |
| InChIKey | IPAUNFJGNGNGAL-TYEWXPTBSA-N |
| XLogP | 6.94 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|