C35H59O8P — CID 134739758
[(2R)-2-decanoyloxy-3-phosphonooxypropyl] (4E,7E,10E,13E,16E)-docosa-4,7,10,13,16-pentaenoate (PubChem CID 134739758) has the molecular formula C35H59O8P and a molecular weight of 638.82 g/mol. Its IUPAC name is [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (4E,7E,10E,13E,16E)-docosa-4,7,10,13,16-pentaenoate.
| Compound Name | [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (4E,7E,10E,13E,16E)-docosa-4,7,10,13,16-pentaenoate |
|---|---|
| PubChem CID | 134739758 |
| Molecular Formula | C35H59O8P |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (4E,7E,10E,13E,16E)-docosa-4,7,10,13,16-pentaenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C35H59O8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-25-27-29-34(36)41-31-33(32-42-44(38,39)40)43-35(37)30-28-26-23-10-8-6-4-2/h11-12,14-15,17-18,20-21,24-25,33H,3-10,13,16,19,22-23,26-32H2,1-2H3,(H2,38,39,40)/b12-11+,15-14+,18-17+,21-20+,25-24+/t33-/m1/s1 |
| InChIKey | IWWTTYSPWACNTK-OYVGPTPWSA-N |
| XLogP | 9.39 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|