C19H30O2 — CID 134739924
(2R,5S,8R,11R)-11-methoxy-6,6,8-trimethyl-2-prop-2-enyltricyclo[6.3.0.01,5]undecane-2-carbaldehyde (PubChem CID 134739924) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (2R,5S,8R,11R)-11-methoxy-6,6,8-trimethyl-2-prop-2-enyltricyclo[6.3.0.01,5]undecane-2-carbaldehyde.
| Compound Name | (2R,5S,8R,11R)-11-methoxy-6,6,8-trimethyl-2-prop-2-enyltricyclo[6.3.0.01,5]undecane-2-carbaldehyde |
|---|---|
| PubChem CID | 134739924 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (2R,5S,8R,11R)-11-methoxy-6,6,8-trimethyl-2-prop-2-enyltricyclo[6.3.0.01,5]undecane-2-carbaldehyde |
| SMILES | C=CC[C@]1(C=O)CCC2C(C)(C)C[C@@]3(C)CC[C@@H](OC)C231 |
| InChI | InChI=1S/C19H30O2/c1-6-9-18(13-20)11-7-14-16(2,3)12-17(4)10-8-15(21-5)19(14,17)18/h6,13-15H,1,7-12H2,2-5H3/t14?,15-,17-,18-,19?/m1/s1 |
| InChIKey | IYIFJDIXWYMMOQ-AIOQGSFRSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|