C46H80NO8P — CID 134740058
[(2R)-3-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxy-2-[(6E,9E)-octadeca-6,9-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134740058) has the molecular formula C46H80NO8P and a molecular weight of 806.12 g/mol. Its IUPAC name is [(2R)-3-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxy-2-[(6E,9E)-octadeca-6,9-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxy-2-[(6E,9E)-octadeca-6,9-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134740058 |
| Molecular Formula | C46H80NO8P |
| Molecular Weight | 806.12 g/mol |
| Exact Mass | 805.56 |
| IUPAC Name | [(2R)-3-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxy-2-[(6E,9E)-octadeca-6,9-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C46H80NO8P/c1-6-8-10-12-14-16-18-20-22-23-25-26-28-30-32-34-36-38-45(48)52-42-44(43-54-56(50,51)53-41-40-47(3,4)5)55-46(49)39-37-35-33-31-29-27-24-21-19-17-15-13-11-9-7-2/h10,12,16,18,21-24,26,28-29,31,44H,6-9,11,13-15,17,19-20,25,27,30,32-43H2,1-5H3/b12-10+,18-16+,23-22+,24-21+,28-26+,31-29+/t44-/m1/s1 |
| InChIKey | IZIGODKCMFCVFN-FUAPBACPSA-N |
| XLogP | 11.61 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.12 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|