C34H67NO8P+ — CID 134742577
2-[hydroxy-[(2S)-3-[(E)-pentadec-9-enoyl]oxy-2-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 134742577) has the molecular formula C34H67NO8P+ and a molecular weight of 648.88 g/mol. Its IUPAC name is 2-[hydroxy-[(2S)-3-[(E)-pentadec-9-enoyl]oxy-2-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2S)-3-[(E)-pentadec-9-enoyl]oxy-2-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134742577 |
| Molecular Formula | C34H67NO8P+ |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.46 |
| IUPAC Name | 2-[hydroxy-[(2S)-3-[(E)-pentadec-9-enoyl]oxy-2-undecanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C/CCCCCCCC(=O)OC[C@@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C34H66NO8P/c1-6-8-10-12-14-16-17-18-19-21-22-24-26-33(36)40-30-32(31-42-44(38,39)41-29-28-35(3,4)5)43-34(37)27-25-23-20-15-13-11-9-7-2/h14,16,32H,6-13,15,17-31H2,1-5H3/p+1/b16-14+/t32-/m0/s1 |
| InChIKey | JVXPBWDSARIGSZ-OPCSARHGSA-O |
| XLogP | 8.68 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|