C47H78O10 — CID 134743340
[(2R)-2-[(9E,11E)-octadeca-9,11-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoate (PubChem CID 134743340) has the molecular formula C47H78O10 and a molecular weight of 803.13 g/mol. Its IUPAC name is [(2R)-2-[(9E,11E)-octadeca-9,11-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoate.
| Compound Name | [(2R)-2-[(9E,11E)-octadeca-9,11-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoate |
|---|---|
| PubChem CID | 134743340 |
| Molecular Formula | C47H78O10 |
| Molecular Weight | 803.13 g/mol |
| Exact Mass | 802.56 |
| IUPAC Name | [(2R)-2-[(9E,11E)-octadeca-9,11-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoate |
| SMILES | CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC[C@@H](CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O)OC(=O)CCCCCCC/C=C/C=C/CCCCCC |
| InChI | InChI=1S/C47H78O10/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-42(49)54-38-40(39-55-47-46(53)45(52)44(51)41(37-48)57-47)56-43(50)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h7,9,13-16,18-21,23,25,40-41,44-48,51-53H,3-6,8,10-12,17,22,24,26-39H2,1-2H3/b9-7+,15-13+,16-14+,20-19+,21-18+,25-23+/t40-,41-,44+,45?,46?,47-/m0/s1 |
| InChIKey | KDIADLCGKQWKJU-QYSWQLELSA-N |
| XLogP | 9.22 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.13 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|