C15H32O3Si — CID 134744518
methyl (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexanoate (PubChem CID 134744518) has the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. Its IUPAC name is methyl (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexanoate.
| Compound Name | methyl (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexanoate |
|---|---|
| PubChem CID | 134744518 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | methyl (2S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylhexanoate |
| SMILES | CC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)OC |
| InChI | InChI=1S/C15H32O3Si/c1-10-11(2)13(12(3)14(16)17-7)18-19(8,9)15(4,5)6/h11-13H,10H2,1-9H3/t11-,12-,13-/m0/s1 |
| InChIKey | KOCLWUYPTOWPJL-AVGNSLFASA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|