About dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane
dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane (PubChem CID 13474636) has the molecular formula C12H25N3Si
and a molecular weight of 239.44 g/mol. Its IUPAC name is dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane.
Molecular Properties
| Compound Name | dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane |
| PubChem CID | 13474636 |
| Molecular Formula | C12H25N3Si |
| Molecular Weight | 239.44 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane |
| SMILES | CCCC[Si](C)(CCCC)Cn1cncn1 |
| InChI | InChI=1S/C12H25N3Si/c1-4-6-8-16(3,9-7-5-2)12-15-11-13-10-14-15/h10-11H,4-9,12H2,1-3H3 |
| InChIKey | NPUNYIAUFYDUMB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane?
The IUPAC name of dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane (CID 13474636) is dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane.
What is the SMILES notation for dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane?
The canonical SMILES for dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane is CCCC[Si](C)(CCCC)Cn1cncn1.
What is the InChIKey of dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane?
The InChIKey is NPUNYIAUFYDUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3Si/c1-4-6-8-16(3,9-7-5-2)12-15-11-13-10-14-15/h10-11H,4-9,12H2,1-3H3.
What are the key properties of dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane?
dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane has a molecular weight of 239.44 g/mol, XLogP of 3.50, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl-methyl-(1,2,4-triazol-1-ylmethyl)silane is sourced from PubChem (CID 13474636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).