C21H16N2OS2 — CID 1347475
6-cyclopropyl-2-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-4-phenylpyridine-3-carbonitrile (PubChem CID 1347475) has the molecular formula C21H16N2OS2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 6-cyclopropyl-2-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-4-phenylpyridine-3-carbonitrile.
| Compound Name | 6-cyclopropyl-2-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 1347475 |
| Molecular Formula | C21H16N2OS2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 6-cyclopropyl-2-(2-oxo-2-thiophen-2-ylethyl)sulfanyl-4-phenylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(C2CC2)nc1SCC(=O)c1cccs1 |
| InChI | InChI=1S/C21H16N2OS2/c22-12-17-16(14-5-2-1-3-6-14)11-18(15-8-9-15)23-21(17)26-13-19(24)20-7-4-10-25-20/h1-7,10-11,15H,8-9,13H2 |
| InChIKey | GFINWUIVKGIGFX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |