C17H13ClFN3O5S — CID 134747701
[[(2S,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]-(1,2,4-triazol-1-yl)methyl] hydrogen sulfate (PubChem CID 134747701) has the molecular formula C17H13ClFN3O5S and a molecular weight of 425.83 g/mol. Its IUPAC name is [[(2S,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]-(1,2,4-triazol-1-yl)methyl] hydrogen sulfate.
| Compound Name | [[(2S,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]-(1,2,4-triazol-1-yl)methyl] hydrogen sulfate |
|---|---|
| PubChem CID | 134747701 |
| Molecular Formula | C17H13ClFN3O5S |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | [[(2S,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]-(1,2,4-triazol-1-yl)methyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)OC(n1cncn1)[C@@]1(c2ccc(F)cc2)O[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C17H13ClFN3O5S/c18-14-4-2-1-3-13(14)15-17(26-15,11-5-7-12(19)8-6-11)16(27-28(23,24)25)22-10-20-9-21-22/h1-10,15-16H,(H,23,24,25)/t15-,16?,17-/m0/s1 |
| InChIKey | LRHLUQVZYPONJN-QRFGZVGRSA-N |
| XLogP | 3.06 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|