C50H86NO8P — CID 134748770
[(2S)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134748770) has the molecular formula C50H86NO8P and a molecular weight of 860.21 g/mol. Its IUPAC name is [(2S)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134748770 |
| Molecular Formula | C50H86NO8P |
| Molecular Weight | 860.21 g/mol |
| Exact Mass | 859.61 |
| IUPAC Name | [(2S)-2-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxy-3-[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O[C@@H](COC(=O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C50H86NO8P/c1-6-8-10-12-14-16-18-20-22-23-24-25-26-27-29-30-32-34-36-38-40-42-49(52)56-46-48(47-58-60(54,55)57-45-44-51(3,4)5)59-50(53)43-41-39-37-35-33-31-28-21-19-17-15-13-11-9-7-2/h9,11,15,17,21-23,25-26,28-30,34,36,48H,6-8,10,12-14,16,18-20,24,27,31-33,35,37-47H2,1-5H3/b11-9+,17-15+,23-22+,26-25+,28-21+,30-29+,36-34+/t48-/m0/s1 |
| InChIKey | MATJBRIUCUCPIK-DICBOAJJSA-N |
| XLogP | 12.94 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.21 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|