C43H78NO8P — CID 134749506
[(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134749506) has the molecular formula C43H78NO8P and a molecular weight of 768.07 g/mol. Its IUPAC name is [(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134749506 |
| Molecular Formula | C43H78NO8P |
| Molecular Weight | 768.07 g/mol |
| Exact Mass | 767.55 |
| IUPAC Name | [(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(9E,12E,15E)-octadeca-9,12,15-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C/CCCCCCC |
| InChI | InChI=1S/C43H78NO8P/c1-6-8-10-12-14-16-18-20-22-24-25-27-29-31-33-35-42(45)49-39-41(40-51-53(47,48)50-38-37-44(3,4)5)52-43(46)36-34-32-30-28-26-23-21-19-17-15-13-11-9-7-2/h8,10,14,16,19-22,41H,6-7,9,11-13,15,17-18,23-40H2,1-5H3/b10-8+,16-14+,21-19+,22-20+/t41-/m1/s1 |
| InChIKey | MHTCDFONKZYJSF-PJVSSPPVSA-N |
| XLogP | 10.89 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.07 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|