C39H70O5 — CID 134751030
[(2S)-3-hydroxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] (E)-octadec-11-enoate (PubChem CID 134751030) has the molecular formula C39H70O5 and a molecular weight of 618.98 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] (E)-octadec-11-enoate.
| Compound Name | [(2S)-3-hydroxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] (E)-octadec-11-enoate |
|---|---|
| PubChem CID | 134751030 |
| Molecular Formula | C39H70O5 |
| Molecular Weight | 618.98 g/mol |
| Exact Mass | 618.52 |
| IUPAC Name | [(2S)-3-hydroxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] (E)-octadec-11-enoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCC/C=C/CCCCCC |
| InChI | InChI=1S/C39H70O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h12-15,18,20,37,40H,3-11,16-17,19,21-36H2,1-2H3/b14-12+,15-13+,20-18+/t37-/m0/s1 |
| InChIKey | MVVNDYZCYMTEHS-IEAGSNMWSA-N |
| XLogP | 11.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.98 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|