C45H76NO8P — CID 134751455
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate (PubChem CID 134751455) has the molecular formula C45H76NO8P and a molecular weight of 790.08 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 134751455 |
| Molecular Formula | C45H76NO8P |
| Molecular Weight | 790.08 g/mol |
| Exact Mass | 789.53 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(7E,10E,13E,16E)-icosa-7,10,13,16-tetraenoyl]oxypropan-2-yl] (5E,8E,11E)-icosa-5,8,11-trienoate |
| SMILES | CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C45H76NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-44(47)51-41-43(42-53-55(49,50)52-40-39-46)54-45(48)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h7,9,13,15,18-21,24-27,30,32,43H,3-6,8,10-12,14,16-17,22-23,28-29,31,33-42,46H2,1-2H3,(H,49,50)/b9-7+,15-13+,20-18+,21-19+,26-24+,27-25+,32-30+/t43-/m1/s1 |
| InChIKey | MZRUZZYXQTWNMU-TVMZPBFBSA-N |
| XLogP | 12.05 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.08 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|