C45H81NO7 — CID 134752223
4-[2-[(E)-hexadec-7-enoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134752223) has the molecular formula C45H81NO7 and a molecular weight of 748.14 g/mol. Its IUPAC name is 4-[2-[(E)-hexadec-7-enoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-[(E)-hexadec-7-enoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134752223 |
| Molecular Formula | C45H81NO7 |
| Molecular Weight | 748.14 g/mol |
| Exact Mass | 747.60 |
| IUPAC Name | 4-[2-[(E)-hexadec-7-enoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCC/C=C/CCCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCCCC/C=C/C=C/CCCCCCCCC |
| InChI | InChI=1S/C45H81NO7/c1-6-8-10-12-14-16-18-20-21-22-24-25-27-29-31-33-35-43(47)52-40-41(39-51-38-37-42(45(49)50)46(3,4)5)53-44(48)36-34-32-30-28-26-23-19-17-15-13-11-9-7-2/h21-26,41-42H,6-20,27-40H2,1-5H3/b22-21+,25-24+,26-23+ |
| InChIKey | NGSCCZCHGMNVBY-BRRBNNQOSA-N |
| XLogP | 10.13 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.14 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|