C41H72NO8P — CID 134753530
[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134753530) has the molecular formula C41H72NO8P and a molecular weight of 738.00 g/mol. Its IUPAC name is [3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134753530 |
| Molecular Formula | C41H72NO8P |
| Molecular Weight | 738.00 g/mol |
| Exact Mass | 737.50 |
| IUPAC Name | [3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CC/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C41H72NO8P/c1-6-8-10-12-14-16-18-20-22-23-25-27-29-31-33-40(43)47-37-39(38-49-51(45,46)48-36-35-42(3,4)5)50-41(44)34-32-30-28-26-24-21-19-17-15-13-11-9-7-2/h8,10,14,16,20-22,24,28,30,39H,6-7,9,11-13,15,17-19,23,25-27,29,31-38H2,1-5H3/b10-8+,16-14+,22-20+,24-21+,30-28+ |
| InChIKey | NSRLMOHSJHIQSN-KJAYTPSJSA-N |
| XLogP | 9.88 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.00 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|