C41H73NO8P+ — CID 134753531
2-[[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 134753531) has the molecular formula C41H73NO8P+ and a molecular weight of 739.01 g/mol. Its IUPAC name is 2-[[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134753531 |
| Molecular Formula | C41H73NO8P+ |
| Molecular Weight | 739.01 g/mol |
| Exact Mass | 738.51 |
| IUPAC Name | 2-[[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(4E,7E)-hexadeca-4,7-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CC/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C41H72NO8P/c1-6-8-10-12-14-16-18-20-22-23-25-27-29-31-33-40(43)47-37-39(38-49-51(45,46)48-36-35-42(3,4)5)50-41(44)34-32-30-28-26-24-21-19-17-15-13-11-9-7-2/h8,10,14,16,20-22,24,28,30,39H,6-7,9,11-13,15,17-19,23,25-27,29,31-38H2,1-5H3/p+1/b10-8+,16-14+,22-20+,24-21+,30-28+ |
| InChIKey | NSRLMOHSJHIQSN-KJAYTPSJSA-O |
| XLogP | 10.51 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.01 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|