C35H63NO7 — CID 134755468
4-[2-[(7E,9E)-tetradeca-7,9-dienoyl]oxy-3-undecanoyloxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134755468) has the molecular formula C35H63NO7 and a molecular weight of 609.89 g/mol. Its IUPAC name is 4-[2-[(7E,9E)-tetradeca-7,9-dienoyl]oxy-3-undecanoyloxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-[(7E,9E)-tetradeca-7,9-dienoyl]oxy-3-undecanoyloxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134755468 |
| Molecular Formula | C35H63NO7 |
| Molecular Weight | 609.89 g/mol |
| Exact Mass | 609.46 |
| IUPAC Name | 4-[2-[(7E,9E)-tetradeca-7,9-dienoyl]oxy-3-undecanoyloxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCC/C=C/C=C/CCCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C35H63NO7/c1-6-8-10-12-14-16-17-18-20-22-24-26-34(38)43-31(29-41-28-27-32(35(39)40)36(3,4)5)30-42-33(37)25-23-21-19-15-13-11-9-7-2/h12,14,16-17,31-32H,6-11,13,15,18-30H2,1-5H3/b14-12+,17-16+ |
| InChIKey | OKMFFYOIOSLCEY-IEZSIOEYSA-N |
| XLogP | 6.46 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.89 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|