C40H56O2 — CID 134755932
(8E,10E,12E,14E,16E,18E,20E,22E,24E)-6,6,10,14,19,23-hexamethyl-25-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]pentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione (PubChem CID 134755932) has the molecular formula C40H56O2 and a molecular weight of 568.89 g/mol. Its IUPAC name is (8E,10E,12E,14E,16E,18E,20E,22E,24E)-6,6,10,14,19,23-hexamethyl-25-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]pentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione.
| Compound Name | (8E,10E,12E,14E,16E,18E,20E,22E,24E)-6,6,10,14,19,23-hexamethyl-25-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]pentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione |
|---|---|
| PubChem CID | 134755932 |
| Molecular Formula | C40H56O2 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.43 |
| IUPAC Name | (8E,10E,12E,14E,16E,18E,20E,22E,24E)-6,6,10,14,19,23-hexamethyl-25-[(1R)-2,6,6-trimethylcyclohex-2-en-1-yl]pentacosa-8,10,12,14,16,18,20,22,24-nonaene-2,7-dione |
| SMILES | CC(=O)CCCC(C)(C)C(=O)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@H]1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C40H56O2/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38(42)40(9,10)30-16-24-36(6)41/h11-14,17-23,25-28,37H,15-16,24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+/t37-/m0/s1 |
| InChIKey | OPGDFUSKKYCZKS-NTXLUARGSA-N |
| XLogP | 11.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|