C47H77O8P — CID 134757967
[(2R)-1-[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate (PubChem CID 134757967) has the molecular formula C47H77O8P and a molecular weight of 801.10 g/mol. Its IUPAC name is [(2R)-1-[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 134757967 |
| Molecular Formula | C47H77O8P |
| Molecular Weight | 801.10 g/mol |
| Exact Mass | 800.54 |
| IUPAC Name | [(2R)-1-[(5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC |
| InChI | InChI=1S/C47H77O8P/c1-3-5-7-9-11-13-15-17-19-21-22-23-24-26-28-30-32-34-36-38-40-42-47(49)55-45(44-54-56(50,51)52)43-53-46(48)41-39-37-35-33-31-29-27-25-20-18-16-14-12-10-8-6-4-2/h12,14,18-21,23-24,27-30,33-36,45H,3-11,13,15-17,22,25-26,31-32,37-44H2,1-2H3,(H2,50,51,52)/b14-12+,20-18+,21-19+,24-23+,29-27+,30-28+,35-33+,36-34+/t45-/m1/s1 |
| InChIKey | PHJMGEHECKRZBX-BZKQSUTQSA-N |
| XLogP | 13.40 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.10 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|