C25H44O2Si — CID 134758304
(2E,6E,10E)-14-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,10,14-trimethylcyclotetradeca-2,6,10-trien-1-one (PubChem CID 134758304) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is (2E,6E,10E)-14-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,10,14-trimethylcyclotetradeca-2,6,10-trien-1-one.
| Compound Name | (2E,6E,10E)-14-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,10,14-trimethylcyclotetradeca-2,6,10-trien-1-one |
|---|---|
| PubChem CID | 134758304 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (2E,6E,10E)-14-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6,10,14-trimethylcyclotetradeca-2,6,10-trien-1-one |
| SMILES | C/C1=C\CC/C(C)=C/CCC(C)(CCO[Si](C)(C)C(C)(C)C)C(=O)/C=C/CC1 |
| InChI | InChI=1S/C25H44O2Si/c1-21-13-9-10-17-23(26)25(6,18-12-16-22(2)15-11-14-21)19-20-27-28(7,8)24(3,4)5/h10,14,16-17H,9,11-13,15,18-20H2,1-8H3/b17-10+,21-14+,22-16+ |
| InChIKey | PKQHKSAHGDFLDE-SBCXIMPHSA-N |
| XLogP | 7.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|