C39H66O5 — CID 134760594
[(2S)-1-hydroxy-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (E)-octadec-11-enoate (PubChem CID 134760594) has the molecular formula C39H66O5 and a molecular weight of 614.95 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (E)-octadec-11-enoate.
| Compound Name | [(2S)-1-hydroxy-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (E)-octadec-11-enoate |
|---|---|
| PubChem CID | 134760594 |
| Molecular Formula | C39H66O5 |
| Molecular Weight | 614.95 g/mol |
| Exact Mass | 614.49 |
| IUPAC Name | [(2S)-1-hydroxy-3-[(6E,9E,12E,15E)-octadeca-6,9,12,15-tetraenoyl]oxypropan-2-yl] (E)-octadec-11-enoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC/C=C/CCCCCC |
| InChI | InChI=1S/C39H66O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-17,19,23,25,37,40H,3-4,6,8-10,12,15,18,20-22,24,26-36H2,1-2H3/b7-5+,13-11+,16-14+,19-17+,25-23+/t37-/m0/s1 |
| InChIKey | QFHXBFXVSWPVCA-SBFUQSFPSA-N |
| XLogP | 10.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.95 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|