C45H82NO8P — CID 134761601
[(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134761601) has the molecular formula C45H82NO8P and a molecular weight of 796.12 g/mol. Its IUPAC name is [(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134761601 |
| Molecular Formula | C45H82NO8P |
| Molecular Weight | 796.12 g/mol |
| Exact Mass | 795.58 |
| IUPAC Name | [(2R)-2-[(E)-heptadec-9-enoyl]oxy-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCC/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C45H82NO8P/c1-6-8-10-12-14-16-18-20-22-23-24-26-27-29-31-33-35-37-44(47)51-41-43(42-53-55(49,50)52-40-39-46(3,4)5)54-45(48)38-36-34-32-30-28-25-21-19-17-15-13-11-9-7-2/h19-22,24,26,29,31,43H,6-18,23,25,27-28,30,32-42H2,1-5H3/b21-19+,22-20+,26-24+,31-29+/t43-/m1/s1 |
| InChIKey | QOCQVIQFGKYVCV-MIFPKNKGSA-N |
| XLogP | 11.67 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.12 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|