C27H32ClN5O2 — CID 13476615
2-[4-[4-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile;hydrochloride (PubChem CID 13476615) has the molecular formula C27H32ClN5O2 and a molecular weight of 494.04 g/mol. Its IUPAC name is 2-[4-[4-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile;hydrochloride.
| Compound Name | 2-[4-[4-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 13476615 |
| Molecular Formula | C27H32ClN5O2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2-[4-[4-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,3'-pyrrolidine]-1'-yl)butyl]piperazin-1-yl]pyridine-3-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccnc1N1CCN(CCCCN2C(=O)CC3(CCCc4ccccc43)C2=O)CC1 |
| InChI | InChI=1S/C27H31N5O2.ClH/c28-20-22-9-6-12-29-25(22)31-17-15-30(16-18-31)13-3-4-14-32-24(33)19-27(26(32)34)11-5-8-21-7-1-2-10-23(21)27;/h1-2,6-7,9-10,12H,3-5,8,11,13-19H2;1H |
| InChIKey | WCNFAXCBJGMTHQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|