About N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide
N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide (PubChem CID 13477003) has the molecular formula C9H13Cl2N3O
and a molecular weight of 250.13 g/mol. Its IUPAC name is N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide.
Molecular Properties
| Compound Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide |
| PubChem CID | 13477003 |
| Molecular Formula | C9H13Cl2N3O |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C(Cl)Cl)n[nH]1 |
| InChI | InChI=1S/C9H13Cl2N3O/c1-9(2,3)5-4-6(14-13-5)12-8(15)7(10)11/h4,7H,1-3H3,(H2,12,13,14,15) |
| InChIKey | KGFDQZLAXSYIOL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide?
The IUPAC name of N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide (CID 13477003) is N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide.
What is the SMILES notation for N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide?
The canonical SMILES for N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide is CC(C)(C)c1cc(NC(=O)C(Cl)Cl)n[nH]1.
What is the InChIKey of N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide?
The InChIKey is KGFDQZLAXSYIOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl2N3O/c1-9(2,3)5-4-6(14-13-5)12-8(15)7(10)11/h4,7H,1-3H3,(H2,12,13,14,15).
What are the key properties of N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide?
N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide has a molecular weight of 250.13 g/mol, XLogP of 2.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-tert-butyl-1H-pyrazol-3-yl)-2,2-dichloroacetamide is sourced from PubChem (CID 13477003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).