C10F19N — CID 13477173
1,1,2,2,3,3,4,4,6,6,7,8,8,9,9,9a-hexadecafluoro-7-(trifluoromethyl)quinolizine (PubChem CID 13477173) has the molecular formula C10F19N and a molecular weight of 495.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,6,6,7,8,8,9,9,9a-hexadecafluoro-7-(trifluoromethyl)quinolizine.
| Compound Name | 1,1,2,2,3,3,4,4,6,6,7,8,8,9,9,9a-hexadecafluoro-7-(trifluoromethyl)quinolizine |
|---|---|
| PubChem CID | 13477173 |
| Molecular Formula | C10F19N |
| Molecular Weight | 495.08 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,6,6,7,8,8,9,9,9a-hexadecafluoro-7-(trifluoromethyl)quinolizine |
| SMILES | FC(F)(F)C1(F)C(F)(F)N2C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F19N/c11-1(8(23,24)25)2(12,13)4(16,17)7(22)5(18,19)3(14,15)6(20,21)10(28,29)30(7)9(1,26)27 |
| InChIKey | YTHKQXBUURIOOD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.08 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|