C19H34O2 — CID 134771763
3-[(2R,5R,8R)-11-methoxy-2,6,6,8-tetramethyl-2-tricyclo[6.3.0.01,5]undecanyl]propan-1-ol (PubChem CID 134771763) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 3-[(2R,5R,8R)-11-methoxy-2,6,6,8-tetramethyl-2-tricyclo[6.3.0.01,5]undecanyl]propan-1-ol.
| Compound Name | 3-[(2R,5R,8R)-11-methoxy-2,6,6,8-tetramethyl-2-tricyclo[6.3.0.01,5]undecanyl]propan-1-ol |
|---|---|
| PubChem CID | 134771763 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | 3-[(2R,5R,8R)-11-methoxy-2,6,6,8-tetramethyl-2-tricyclo[6.3.0.01,5]undecanyl]propan-1-ol |
| SMILES | COC1CC[C@]2(C)CC(C)(C)C3CC[C@](C)(CCCO)C132 |
| InChI | InChI=1S/C19H34O2/c1-16(2)13-18(4)11-8-15(21-5)19(18)14(16)7-10-17(19,3)9-6-12-20/h14-15,20H,6-13H2,1-5H3/t14?,15?,17-,18+,19?/m0/s1 |
| InChIKey | UVAHUFINWOHERU-AVUYLXJFSA-N |
| XLogP | 4.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |