C31H45NO4Si — CID 134774958
tert-butyl N-benzyl-N-[(E,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyl-1-phenylhex-1-en-3-yl]carbamate (PubChem CID 134774958) has the molecular formula C31H45NO4Si and a molecular weight of 523.79 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(E,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyl-1-phenylhex-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(E,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyl-1-phenylhex-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 134774958 |
| Molecular Formula | C31H45NO4Si |
| Molecular Weight | 523.79 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | tert-butyl N-benzyl-N-[(E,3R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyl-1-phenylhex-1-en-3-yl]carbamate |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)[C@@H](/C=C/c1ccccc1)N(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H45NO4Si/c1-24(36-37(8,9)31(5,6)7)27(23-33)28(21-20-25-16-12-10-13-17-25)32(29(34)35-30(2,3)4)22-26-18-14-11-15-19-26/h10-21,23-24,27-28H,22H2,1-9H3/b21-20+/t24-,27-,28+/m0/s1 |
| InChIKey | VZNZSBRDDIDWSF-WFZVLGQDSA-N |
| XLogP | 7.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.79 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|