About diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate
diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate (PubChem CID 13477691) has the molecular formula C17H20F3NO4
and a molecular weight of 359.34 g/mol. Its IUPAC name is diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate |
| PubChem CID | 13477691 |
| Molecular Formula | C17H20F3NO4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN(c1ccc(F)c(F)c1F)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C17H20F3NO4/c1-5-24-16(22)11(17(23)25-6-2)9-21(10(3)4)13-8-7-12(18)14(19)15(13)20/h7-10H,5-6H2,1-4H3 |
| InChIKey | XQIIPHXYBGEIFJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate?
The IUPAC name of diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate (CID 13477691) is diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate.
What is the SMILES notation for diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate?
The canonical SMILES for diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate is CCOC(=O)C(=CN(c1ccc(F)c(F)c1F)C(C)C)C(=O)OCC.
What is the InChIKey of diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate?
The InChIKey is XQIIPHXYBGEIFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F3NO4/c1-5-24-16(22)11(17(23)25-6-2)9-21(10(3)4)13-8-7-12(18)14(19)15(13)20/h7-10H,5-6H2,1-4H3.
What are the key properties of diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate?
diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate has a molecular weight of 359.34 g/mol, XLogP of 3.33, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(2,3,4-trifluoro-N-propan-2-ylanilino)methylidene]propanedioate is sourced from PubChem (CID 13477691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).