C48H90NO7+ — CID 134776910
[1-carboxy-3-[2-[(E)-icos-11-enoyl]oxy-3-[(E)-octadec-11-enoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134776910) has the molecular formula C48H90NO7+ and a molecular weight of 793.25 g/mol. Its IUPAC name is [1-carboxy-3-[2-[(E)-icos-11-enoyl]oxy-3-[(E)-octadec-11-enoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-[(E)-icos-11-enoyl]oxy-3-[(E)-octadec-11-enoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134776910 |
| Molecular Formula | C48H90NO7+ |
| Molecular Weight | 793.25 g/mol |
| Exact Mass | 792.67 |
| IUPAC Name | [1-carboxy-3-[2-[(E)-icos-11-enoyl]oxy-3-[(E)-octadec-11-enoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)OCC(COCCC(C(=O)O)[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C48H89NO7/c1-6-8-10-12-14-16-18-20-22-23-25-27-29-31-33-35-37-39-47(51)56-44(42-54-41-40-45(48(52)53)49(3,4)5)43-55-46(50)38-36-34-32-30-28-26-24-21-19-17-15-13-11-9-7-2/h17,19-20,22,44-45H,6-16,18,21,23-43H2,1-5H3/p+1/b19-17+,22-20+ |
| InChIKey | WRYFVWUADVDDEX-ZEYSCXRRSA-O |
| XLogP | 12.86 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.25 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|