C39H69O8P — CID 134777185
[(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-phosphonooxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate (PubChem CID 134777185) has the molecular formula C39H69O8P and a molecular weight of 696.95 g/mol. Its IUPAC name is [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-phosphonooxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate.
| Compound Name | [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-phosphonooxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 134777185 |
| Molecular Formula | C39H69O8P |
| Molecular Weight | 696.95 g/mol |
| Exact Mass | 696.47 |
| IUPAC Name | [(2R)-2-[(E)-hexadec-7-enoyl]oxy-3-phosphonooxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
| SMILES | CCCCCCCC/C=C/C/C=C/C/C=C/CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C39H69O8P/c1-3-5-7-9-11-13-15-17-18-19-20-22-23-25-27-29-31-33-38(40)45-35-37(36-46-48(42,43)44)47-39(41)34-32-30-28-26-24-21-16-14-12-10-8-6-4-2/h17-18,20-22,24-25,27,37H,3-16,19,23,26,28-36H2,1-2H3,(H2,42,43,44)/b18-17+,22-20+,24-21+,27-25+/t37-/m1/s1 |
| InChIKey | WUHRLAAYSKGXAU-CVYULZJSSA-N |
| XLogP | 11.18 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.95 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|