C51H86O10 — CID 134777655
[(2R)-2-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate (PubChem CID 134777655) has the molecular formula C51H86O10 and a molecular weight of 859.24 g/mol. Its IUPAC name is [(2R)-2-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-2-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 134777655 |
| Molecular Formula | C51H86O10 |
| Molecular Weight | 859.24 g/mol |
| Exact Mass | 858.62 |
| IUPAC Name | [(2R)-2-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@@H](COC(=O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC)CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C51H86O10/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-24-26-27-29-31-33-35-37-39-46(53)58-42-44(43-59-51-50(57)49(56)48(55)45(41-52)61-51)60-47(54)40-38-36-34-32-30-28-25-18-16-14-12-10-8-6-4-2/h12,14,18-20,22-23,25-27,31,33,44-45,48-52,55-57H,3-11,13,15-17,21,24,28-30,32,34-43H2,1-2H3/b14-12+,20-19+,23-22+,25-18+,27-26+,33-31+/t44-,45-,48+,49?,50?,51-/m0/s1 |
| InChIKey | WZEFVSQGWJJKAA-RGACWMEASA-N |
| XLogP | 10.78 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.24 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|