C52H85NO8P+ — CID 134777778
2-[[(2R)-2,3-bis[[(7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 134777778) has the molecular formula C52H85NO8P+ and a molecular weight of 883.22 g/mol. Its IUPAC name is 2-[[(2R)-2,3-bis[[(7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2,3-bis[[(7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 134777778 |
| Molecular Formula | C52H85NO8P+ |
| Molecular Weight | 883.22 g/mol |
| Exact Mass | 882.60 |
| IUPAC Name | 2-[[(2R)-2,3-bis[[(7E,10E,13E,16E,19E)-docosa-7,10,13,16,19-pentaenoyl]oxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CC |
| InChI | InChI=1S/C52H84NO8P/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-42-44-51(54)58-48-50(49-60-62(56,57)59-47-46-53(3,4)5)61-52(55)45-43-41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h8-11,14-17,20-23,26-29,32-35,50H,6-7,12-13,18-19,24-25,30-31,36-49H2,1-5H3/p+1/b10-8+,11-9+,16-14+,17-15+,22-20+,23-21+,28-26+,29-27+,34-32+,35-33+/t50-/m1/s1 |
| InChIKey | XAFPNZQFSGKDDB-XOLILEMWSA-O |
| XLogP | 13.69 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.22 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|